C29H40N2O4S2 — CID 3720140
1,4-bis[(4-cyclohexylphenyl)sulfonyl]-1,4-diazepane (PubChem CID 3720140) has the molecular formula C29H40N2O4S2 and a molecular weight of 544.78 g/mol. Its IUPAC name is 1,4-bis[(4-cyclohexylphenyl)sulfonyl]-1,4-diazepane.
| Compound Name | 1,4-bis[(4-cyclohexylphenyl)sulfonyl]-1,4-diazepane |
|---|---|
| PubChem CID | 3720140 |
| Molecular Formula | C29H40N2O4S2 |
| Molecular Weight | 544.78 g/mol |
| Exact Mass | 544.24 |
| IUPAC Name | 1,4-bis[(4-cyclohexylphenyl)sulfonyl]-1,4-diazepane |
| SMILES | O=S(=O)(c1ccc(C2CCCCC2)cc1)N1CCCN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C29H40N2O4S2/c32-36(33,28-16-12-26(13-17-28)24-8-3-1-4-9-24)30-20-7-21-31(23-22-30)37(34,35)29-18-14-27(15-19-29)25-10-5-2-6-11-25/h12-19,24-25H,1-11,20-23H2 |
| InChIKey | DVEFRUAOSRZQQH-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.78 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |