C19H29N3O3S — CID 9442944
(2R)-2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]propanamide (PubChem CID 9442944) has the molecular formula C19H29N3O3S and a molecular weight of 379.53 g/mol. Its IUPAC name is (2R)-2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]propanamide.
| Compound Name | (2R)-2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 9442944 |
| Molecular Formula | C19H29N3O3S |
| Molecular Weight | 379.53 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | (2R)-2-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]propanamide |
| SMILES | C[C@H](C(N)=O)N1CCN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C19H29N3O3S/c1-15(19(20)23)21-11-13-22(14-12-21)26(24,25)18-9-7-17(8-10-18)16-5-3-2-4-6-16/h7-10,15-16H,2-6,11-14H2,1H3,(H2,20,23)/t15-/m1/s1 |
| InChIKey | ICQWTKSLUYDZKF-OAHLLOKOSA-N |
| XLogP | 1.91 |
| TPSA | 83.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.53 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |