C20H29N3O2S — CID 8694796
(2S)-3-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile (PubChem CID 8694796) has the molecular formula C20H29N3O2S and a molecular weight of 375.54 g/mol. Its IUPAC name is (2S)-3-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile.
| Compound Name | (2S)-3-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 8694796 |
| Molecular Formula | C20H29N3O2S |
| Molecular Weight | 375.54 g/mol |
| Exact Mass | 375.20 |
| IUPAC Name | (2S)-3-[4-(4-cyclohexylphenyl)sulfonylpiperazin-1-yl]-2-methylpropanenitrile |
| SMILES | C[C@H](C#N)CN1CCN(S(=O)(=O)c2ccc(C3CCCCC3)cc2)CC1 |
| InChI | InChI=1S/C20H29N3O2S/c1-17(15-21)16-22-11-13-23(14-12-22)26(24,25)20-9-7-19(8-10-20)18-5-3-2-4-6-18/h7-10,17-18H,2-6,11-14,16H2,1H3/t17-/m1/s1 |
| InChIKey | DDFSVPQBIJIEBJ-QGZVFWFLSA-N |
| XLogP | 3.20 |
| TPSA | 64.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |