C16H28N4O3S — CID 60578931
6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-pentan-2-ylpyridine-3-sulfonamide (PubChem CID 60578931) has the molecular formula C16H28N4O3S and a molecular weight of 356.49 g/mol. Its IUPAC name is 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-pentan-2-ylpyridine-3-sulfonamide.
| Compound Name | 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-pentan-2-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 60578931 |
| Molecular Formula | C16H28N4O3S |
| Molecular Weight | 356.49 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 6-[4-(2-hydroxyethyl)piperazin-1-yl]-N-pentan-2-ylpyridine-3-sulfonamide |
| SMILES | CCCC(C)NS(=O)(=O)c1ccc(N2CCN(CCO)CC2)nc1 |
| InChI | InChI=1S/C16H28N4O3S/c1-3-4-14(2)18-24(22,23)15-5-6-16(17-13-15)20-9-7-19(8-10-20)11-12-21/h5-6,13-14,18,21H,3-4,7-12H2,1-2H3 |
| InChIKey | JPBQHFNLVASJIE-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 85.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.49 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |