C18H30N4O2S — CID 133305726
6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-pentan-3-ylpyridine-3-sulfonamide (PubChem CID 133305726) has the molecular formula C18H30N4O2S and a molecular weight of 366.53 g/mol. Its IUPAC name is 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-pentan-3-ylpyridine-3-sulfonamide.
| Compound Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-pentan-3-ylpyridine-3-sulfonamide |
|---|---|
| PubChem CID | 133305726 |
| Molecular Formula | C18H30N4O2S |
| Molecular Weight | 366.53 g/mol |
| Exact Mass | 366.21 |
| IUPAC Name | 6-(1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazin-2-yl)-N-pentan-3-ylpyridine-3-sulfonamide |
| SMILES | CCC(CC)NS(=O)(=O)c1ccc(N2CCN3CCCCC3C2)nc1 |
| InChI | InChI=1S/C18H30N4O2S/c1-3-15(4-2)20-25(23,24)17-8-9-18(19-13-17)22-12-11-21-10-6-5-7-16(21)14-22/h8-9,13,15-16,20H,3-7,10-12,14H2,1-2H3 |
| InChIKey | BDRBMBGRRICMGL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.53 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |