C17H27N3O4S — CID 122106763
5-methyl-1-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperidine-3-carboxylic acid (PubChem CID 122106763) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is 5-methyl-1-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperidine-3-carboxylic acid.
| Compound Name | 5-methyl-1-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 122106763 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 5-methyl-1-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]piperidine-3-carboxylic acid |
| SMILES | CCC(CC)NS(=O)(=O)c1ccc(N2CC(C)CC(C(=O)O)C2)nc1 |
| InChI | InChI=1S/C17H27N3O4S/c1-4-14(5-2)19-25(23,24)15-6-7-16(18-9-15)20-10-12(3)8-13(11-20)17(21)22/h6-7,9,12-14,19H,4-5,8,10-11H2,1-3H3,(H,21,22) |
| InChIKey | HTZSKGSJLKOBEH-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |