C13H21N3O4S — CID 122058332
2-[[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 122058332) has the molecular formula C13H21N3O4S and a molecular weight of 315.40 g/mol. Its IUPAC name is 2-[[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 2-[[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122058332 |
| Molecular Formula | C13H21N3O4S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | 2-[[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | CCC(CC)NS(=O)(=O)c1ccc(NC(C)C(=O)O)nc1 |
| InChI | InChI=1S/C13H21N3O4S/c1-4-10(5-2)16-21(19,20)11-6-7-12(14-8-11)15-9(3)13(17)18/h6-10,16H,4-5H2,1-3H3,(H,14,15)(H,17,18) |
| InChIKey | MEAQLCXXDDKFLC-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 108.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |