C14H23N3O4S — CID 122059482
3-[methyl-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid (PubChem CID 122059482) has the molecular formula C14H23N3O4S and a molecular weight of 329.42 g/mol. Its IUPAC name is 3-[methyl-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid.
| Compound Name | 3-[methyl-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid |
|---|---|
| PubChem CID | 122059482 |
| Molecular Formula | C14H23N3O4S |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.14 |
| IUPAC Name | 3-[methyl-[5-(pentan-3-ylsulfamoyl)-2-pyridinyl]amino]propanoic acid |
| SMILES | CCC(CC)NS(=O)(=O)c1ccc(N(C)CCC(=O)O)nc1 |
| InChI | InChI=1S/C14H23N3O4S/c1-4-11(5-2)16-22(20,21)12-6-7-13(15-10-12)17(3)9-8-14(18)19/h6-7,10-11,16H,4-5,8-9H2,1-3H3,(H,18,19) |
| InChIKey | TYGVHAZLYLTCGX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |