C9H12N2O6S2 — CID 120660271
(2S)-2-[(6-methylsulfonyl-3-pyridinyl)sulfonylamino]propanoic acid (PubChem CID 120660271) has the molecular formula C9H12N2O6S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is (2S)-2-[(6-methylsulfonyl-3-pyridinyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[(6-methylsulfonyl-3-pyridinyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 120660271 |
| Molecular Formula | C9H12N2O6S2 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.01 |
| IUPAC Name | (2S)-2-[(6-methylsulfonyl-3-pyridinyl)sulfonylamino]propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(S(C)(=O)=O)nc1)C(=O)O |
| InChI | InChI=1S/C9H12N2O6S2/c1-6(9(12)13)11-19(16,17)7-3-4-8(10-5-7)18(2,14)15/h3-6,11H,1-2H3,(H,12,13)/t6-/m0/s1 |
| InChIKey | FWWYKJOXCUSNEB-LURJTMIESA-N |
| XLogP | -0.76 |
| TPSA | 130.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |