C8H10N2O4S — CID 122069786
(2S)-2-(pyridin-2-ylsulfonylamino)propanoic acid (PubChem CID 122069786) has the molecular formula C8H10N2O4S and a molecular weight of 230.25 g/mol. Its IUPAC name is (2S)-2-(pyridin-2-ylsulfonylamino)propanoic acid.
| Compound Name | (2S)-2-(pyridin-2-ylsulfonylamino)propanoic acid |
|---|---|
| PubChem CID | 122069786 |
| Molecular Formula | C8H10N2O4S |
| Molecular Weight | 230.25 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (2S)-2-(pyridin-2-ylsulfonylamino)propanoic acid |
| SMILES | C[C@H](NS(=O)(=O)c1ccccn1)C(=O)O |
| InChI | InChI=1S/C8H10N2O4S/c1-6(8(11)12)10-15(13,14)7-4-2-3-5-9-7/h2-6,10H,1H3,(H,11,12)/t6-/m0/s1 |
| InChIKey | OZOWMAWPOLEZLF-LURJTMIESA-N |
| XLogP | -0.17 |
| TPSA | 96.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.25 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |