C16H18N4O4S — CID 8978780
(2S)-2-[[4-[(Z)-C-methyl-N-(pyridin-2-ylamino)carbonimidoyl]phenyl]sulfonylamino]propanoic acid (PubChem CID 8978780) has the molecular formula C16H18N4O4S and a molecular weight of 362.41 g/mol. Its IUPAC name is (2S)-2-[[4-[(Z)-C-methyl-N-(pyridin-2-ylamino)carbonimidoyl]phenyl]sulfonylamino]propanoic acid.
| Compound Name | (2S)-2-[[4-[(Z)-C-methyl-N-(pyridin-2-ylamino)carbonimidoyl]phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 8978780 |
| Molecular Formula | C16H18N4O4S |
| Molecular Weight | 362.41 g/mol |
| Exact Mass | 362.10 |
| IUPAC Name | (2S)-2-[[4-[(Z)-C-methyl-N-(pyridin-2-ylamino)carbonimidoyl]phenyl]sulfonylamino]propanoic acid |
| SMILES | C/C(=N/Nc1ccccn1)c1ccc(S(=O)(=O)N[C@@H](C)C(=O)O)cc1 |
| InChI | InChI=1S/C16H18N4O4S/c1-11(18-19-15-5-3-4-10-17-15)13-6-8-14(9-7-13)25(23,24)20-12(2)16(21)22/h3-10,12,20H,1-2H3,(H,17,19)(H,21,22)/b18-11-/t12-/m0/s1 |
| InChIKey | XMZBVZHTZWCXKV-SJWFJVLYSA-N |
| XLogP | 1.67 |
| TPSA | 120.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.41 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|