C13H12FN3 — CID 6145584
N-[(Z)-1-(4-fluorophenyl)ethylideneamino]pyridin-2-amine (PubChem CID 6145584) has the molecular formula C13H12FN3 and a molecular weight of 229.26 g/mol. Its IUPAC name is N-[(Z)-1-(4-fluorophenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | N-[(Z)-1-(4-fluorophenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 6145584 |
| Molecular Formula | C13H12FN3 |
| Molecular Weight | 229.26 g/mol |
| Exact Mass | 229.10 |
| IUPAC Name | N-[(Z)-1-(4-fluorophenyl)ethylideneamino]pyridin-2-amine |
| SMILES | C/C(=N/Nc1ccccn1)c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN3/c1-10(11-5-7-12(14)8-6-11)16-17-13-4-2-3-9-15-13/h2-9H,1H3,(H,15,17)/b16-10- |
| InChIKey | KGAQRUQIWZQLNP-YBEGLDIGSA-N |
| XLogP | 3.06 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.26 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|