C19H17N3 — CID 3582287
N-[1-(4-phenylphenyl)ethylideneamino]pyridin-2-amine (PubChem CID 3582287) has the molecular formula C19H17N3 and a molecular weight of 287.37 g/mol. Its IUPAC name is N-[1-(4-phenylphenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | N-[1-(4-phenylphenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 3582287 |
| Molecular Formula | C19H17N3 |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | N-[1-(4-phenylphenyl)ethylideneamino]pyridin-2-amine |
| SMILES | CC(=NNc1ccccn1)c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C19H17N3/c1-15(21-22-19-9-5-6-14-20-19)16-10-12-18(13-11-16)17-7-3-2-4-8-17/h2-14H,1H3,(H,20,22) |
| InChIKey | CJXDJGIBHVQFOL-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|