C16H19N3O3 — CID 4546533
N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]pyridin-2-amine (PubChem CID 4546533) has the molecular formula C16H19N3O3 and a molecular weight of 301.35 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]pyridin-2-amine.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]pyridin-2-amine |
|---|---|
| PubChem CID | 4546533 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]pyridin-2-amine |
| SMILES | COc1cc(C(C)=NNc2ccccn2)cc(OC)c1OC |
| InChI | InChI=1S/C16H19N3O3/c1-11(18-19-15-7-5-6-8-17-15)12-9-13(20-2)16(22-4)14(10-12)21-3/h5-10H,1-4H3,(H,17,19) |
| InChIKey | PIZZEQVHDCBFTR-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|