C12H16N6O3 — CID 4985798
N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine (PubChem CID 4985798) has the molecular formula C12H16N6O3 and a molecular weight of 292.30 g/mol. Its IUPAC name is N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine.
| Compound Name | N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine |
|---|---|
| PubChem CID | 4985798 |
| Molecular Formula | C12H16N6O3 |
| Molecular Weight | 292.30 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | N-[1-(3,4,5-trimethoxyphenyl)ethylideneamino]-2H-tetrazol-5-amine |
| SMILES | COc1cc(C(C)=NNc2nn[nH]n2)cc(OC)c1OC |
| InChI | InChI=1S/C12H16N6O3/c1-7(13-14-12-15-17-18-16-12)8-5-9(19-2)11(21-4)10(6-8)20-3/h5-6H,1-4H3,(H2,14,15,16,17,18) |
| InChIKey | BTNCTTYTQOXYQF-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 106.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|