C12H19N4O3+ — CID 7689582
diaminomethylidene-[(Z)-1-(3,4,5-trimethoxyphenyl)ethylideneamino]azanium (PubChem CID 7689582) has the molecular formula C12H19N4O3+ and a molecular weight of 267.31 g/mol. Its IUPAC name is diaminomethylidene-[(Z)-1-(3,4,5-trimethoxyphenyl)ethylideneamino]azanium.
| Compound Name | diaminomethylidene-[(Z)-1-(3,4,5-trimethoxyphenyl)ethylideneamino]azanium |
|---|---|
| PubChem CID | 7689582 |
| Molecular Formula | C12H19N4O3+ |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | diaminomethylidene-[(Z)-1-(3,4,5-trimethoxyphenyl)ethylideneamino]azanium |
| SMILES | COc1cc(/C(C)=N\[NH+]=C(N)N)cc(OC)c1OC |
| InChI | InChI=1S/C12H18N4O3/c1-7(15-16-12(13)14)8-5-9(17-2)11(19-4)10(6-8)18-3/h5-6H,1-4H3,(H4,13,14,16)/p+1/b15-7- |
| InChIKey | NAYYSNYMTKYYDZ-CHHVJCJISA-O |
| XLogP | -1.21 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|