C12H17NO5 — CID 155455592
hydroxymethyl 3,4,5-trimethoxy-N-methylbenzenecarboximidate (PubChem CID 155455592) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is hydroxymethyl 3,4,5-trimethoxy-N-methylbenzenecarboximidate.
| Compound Name | hydroxymethyl 3,4,5-trimethoxy-N-methylbenzenecarboximidate |
|---|---|
| PubChem CID | 155455592 |
| Molecular Formula | C12H17NO5 |
| Molecular Weight | 255.27 g/mol |
| Exact Mass | 255.11 |
| IUPAC Name | hydroxymethyl 3,4,5-trimethoxy-N-methylbenzenecarboximidate |
| SMILES | C/N=C(\OCO)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C12H17NO5/c1-13-12(18-7-14)8-5-9(15-2)11(17-4)10(6-8)16-3/h5-6,14H,7H2,1-4H3/b13-12- |
| InChIKey | YOUMOYNHTICTDX-SEYXRHQNSA-N |
| XLogP | 1.06 |
| TPSA | 69.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.27 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|