C11H16ClNO4 — CID 22281599
2-amino-1-(3,4,5-trimethoxyphenyl)ethanone;hydrochloride (PubChem CID 22281599) has the molecular formula C11H16ClNO4 and a molecular weight of 261.70 g/mol. Its IUPAC name is 2-amino-1-(3,4,5-trimethoxyphenyl)ethanone;hydrochloride.
| Compound Name | 2-amino-1-(3,4,5-trimethoxyphenyl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 22281599 |
| Molecular Formula | C11H16ClNO4 |
| Molecular Weight | 261.70 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | 2-amino-1-(3,4,5-trimethoxyphenyl)ethanone;hydrochloride |
| SMILES | COc1cc(C(=O)CN)cc(OC)c1OC.Cl |
| InChI | InChI=1S/C11H15NO4.ClH/c1-14-9-4-7(8(13)6-12)5-10(15-2)11(9)16-3;/h4-5H,6,12H2,1-3H3;1H |
| InChIKey | PMZQIFNVSBXCRL-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.70 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |