C18H29NO4 — CID 40584793
N,N-bis[(2S)-butan-2-yl]-3,4,5-trimethoxybenzamide (PubChem CID 40584793) has the molecular formula C18H29NO4 and a molecular weight of 323.43 g/mol. Its IUPAC name is N,N-bis[(2S)-butan-2-yl]-3,4,5-trimethoxybenzamide.
| Compound Name | N,N-bis[(2S)-butan-2-yl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 40584793 |
| Molecular Formula | C18H29NO4 |
| Molecular Weight | 323.43 g/mol |
| Exact Mass | 323.21 |
| IUPAC Name | N,N-bis[(2S)-butan-2-yl]-3,4,5-trimethoxybenzamide |
| SMILES | CC[C@H](C)N(C(=O)c1cc(OC)c(OC)c(OC)c1)[C@@H](C)CC |
| InChI | InChI=1S/C18H29NO4/c1-8-12(3)19(13(4)9-2)18(20)14-10-15(21-5)17(23-7)16(11-14)22-6/h10-13H,8-9H2,1-7H3/t12-,13-/m0/s1 |
| InChIKey | DXBOKWYWLTXTDK-STQMWFEESA-N |
| XLogP | 3.75 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |