C16H23NO6 — CID 119955341
2-[butan-2-yl-(3,4,5-trimethoxybenzoyl)amino]acetic acid (PubChem CID 119955341) has the molecular formula C16H23NO6 and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-[butan-2-yl-(3,4,5-trimethoxybenzoyl)amino]acetic acid.
| Compound Name | 2-[butan-2-yl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 119955341 |
| Molecular Formula | C16H23NO6 |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | 2-[butan-2-yl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
| SMILES | CCC(C)N(CC(=O)O)C(=O)c1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C16H23NO6/c1-6-10(2)17(9-14(18)19)16(20)11-7-12(21-3)15(23-5)13(8-11)22-4/h7-8,10H,6,9H2,1-5H3,(H,18,19) |
| InChIKey | KCCBKQBQOCSSTJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |