C14H19NO7 — CID 71370887
2-[2-hydroxyethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid (PubChem CID 71370887) has the molecular formula C14H19NO7 and a molecular weight of 313.31 g/mol. Its IUPAC name is 2-[2-hydroxyethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid.
| Compound Name | 2-[2-hydroxyethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
|---|---|
| PubChem CID | 71370887 |
| Molecular Formula | C14H19NO7 |
| Molecular Weight | 313.31 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 2-[2-hydroxyethyl-(3,4,5-trimethoxybenzoyl)amino]acetic acid |
| SMILES | COc1cc(C(=O)N(CCO)CC(=O)O)cc(OC)c1OC |
| InChI | InChI=1S/C14H19NO7/c1-20-10-6-9(7-11(21-2)13(10)22-3)14(19)15(4-5-16)8-12(17)18/h6-7,16H,4-5,8H2,1-3H3,(H,17,18) |
| InChIKey | JPYGUEOXLQVFTR-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.31 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |