C13H20N2O5 — CID 82183920
5-amino-N,N-bis(2-hydroxyethyl)-2,3-dimethoxybenzamide (PubChem CID 82183920) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is 5-amino-N,N-bis(2-hydroxyethyl)-2,3-dimethoxybenzamide.
| Compound Name | 5-amino-N,N-bis(2-hydroxyethyl)-2,3-dimethoxybenzamide |
|---|---|
| PubChem CID | 82183920 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | 5-amino-N,N-bis(2-hydroxyethyl)-2,3-dimethoxybenzamide |
| SMILES | COc1cc(N)cc(C(=O)N(CCO)CCO)c1OC |
| InChI | InChI=1S/C13H20N2O5/c1-19-11-8-9(14)7-10(12(11)20-2)13(18)15(3-5-16)4-6-17/h7-8,16-17H,3-6,14H2,1-2H3 |
| InChIKey | DGOSTINEAVYDIC-UHFFFAOYSA-N |
| XLogP | -0.29 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|