C16H26N2O5 — CID 82071574
3-(5-amino-2-ethoxy-3-methoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide (PubChem CID 82071574) has the molecular formula C16H26N2O5 and a molecular weight of 326.39 g/mol. Its IUPAC name is 3-(5-amino-2-ethoxy-3-methoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide.
| Compound Name | 3-(5-amino-2-ethoxy-3-methoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 82071574 |
| Molecular Formula | C16H26N2O5 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 3-(5-amino-2-ethoxy-3-methoxyphenyl)-N,N-bis(2-hydroxyethyl)propanamide |
| SMILES | CCOc1c(CCC(=O)N(CCO)CCO)cc(N)cc1OC |
| InChI | InChI=1S/C16H26N2O5/c1-3-23-16-12(10-13(17)11-14(16)22-2)4-5-15(21)18(6-8-19)7-9-20/h10-11,19-20H,3-9,17H2,1-2H3 |
| InChIKey | AVQZRSUFQZQHBD-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 105.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|