C15H24N2O4 — CID 82183862
3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide (PubChem CID 82183862) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide.
| Compound Name | 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
|---|---|
| PubChem CID | 82183862 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
| SMILES | CCN(CCO)C(=O)CCc1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C15H24N2O4/c1-4-17(7-8-18)15(19)6-5-11-9-12(16)14(21-3)10-13(11)20-2/h9-10,18H,4-8,16H2,1-3H3 |
| InChIKey | LUFRNWIMGDHASE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|