About 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide
3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide (PubChem CID 82183862) has the molecular formula C15H24N2O4
and a molecular weight of 296.37 g/mol. Its IUPAC name is 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide.
Molecular Properties
| Compound Name | 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
| PubChem CID | 82183862 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide |
| SMILES | CCN(CCO)C(=O)CCc1cc(N)c(OC)cc1OC |
| InChI | InChI=1S/C15H24N2O4/c1-4-17(7-8-18)15(19)6-5-11-9-12(16)14(21-3)10-13(11)20-2/h9-10,18H,4-8,16H2,1-3H3 |
| InChIKey | LUFRNWIMGDHASE-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide?
The IUPAC name of 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide (CID 82183862) is 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide.
What is the SMILES notation for 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide?
The canonical SMILES for 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide is CCN(CCO)C(=O)CCc1cc(N)c(OC)cc1OC.
What is the InChIKey of 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide?
The InChIKey is LUFRNWIMGDHASE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H24N2O4/c1-4-17(7-8-18)15(19)6-5-11-9-12(16)14(21-3)10-13(11)20-2/h9-10,18H,4-8,16H2,1-3H3.
What are the key properties of 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide?
3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide has a molecular weight of 296.37 g/mol, XLogP of 1.06, 8 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-amino-2,4-dimethoxyphenyl)-N-ethyl-N-(2-hydroxyethyl)propanamide is sourced from PubChem (CID 82183862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).