C13H20N2O4 — CID 112606111
2-amino-N-ethyl-N-(2-hydroxyethyl)-3,5-dimethoxybenzamide (PubChem CID 112606111) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-amino-N-ethyl-N-(2-hydroxyethyl)-3,5-dimethoxybenzamide.
| Compound Name | 2-amino-N-ethyl-N-(2-hydroxyethyl)-3,5-dimethoxybenzamide |
|---|---|
| PubChem CID | 112606111 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-amino-N-ethyl-N-(2-hydroxyethyl)-3,5-dimethoxybenzamide |
| SMILES | CCN(CCO)C(=O)c1cc(OC)cc(OC)c1N |
| InChI | InChI=1S/C13H20N2O4/c1-4-15(5-6-16)13(17)10-7-9(18-2)8-11(19-3)12(10)14/h7-8,16H,4-6,14H2,1-3H3 |
| InChIKey | QNSFXPFTEABBAE-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 85.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|