C13H20N2O4 — CID 112606170
2-(dimethylamino)ethyl 2-amino-3,5-dimethoxybenzoate (PubChem CID 112606170) has the molecular formula C13H20N2O4 and a molecular weight of 268.31 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl 2-amino-3,5-dimethoxybenzoate.
| Compound Name | 2-(dimethylamino)ethyl 2-amino-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 112606170 |
| Molecular Formula | C13H20N2O4 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | 2-(dimethylamino)ethyl 2-amino-3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)c(N)c(C(=O)OCCN(C)C)c1 |
| InChI | InChI=1S/C13H20N2O4/c1-15(2)5-6-19-13(16)10-7-9(17-3)8-11(18-4)12(10)14/h7-8H,5-6,14H2,1-4H3 |
| InChIKey | MCMMGNRKPLQVMN-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|