C12H14F3NO4S — CID 116617304
2-(trifluoromethylsulfanyl)ethyl 2-amino-3,5-dimethoxybenzoate (PubChem CID 116617304) has the molecular formula C12H14F3NO4S and a molecular weight of 325.31 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanyl)ethyl 2-amino-3,5-dimethoxybenzoate.
| Compound Name | 2-(trifluoromethylsulfanyl)ethyl 2-amino-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 116617304 |
| Molecular Formula | C12H14F3NO4S |
| Molecular Weight | 325.31 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 2-(trifluoromethylsulfanyl)ethyl 2-amino-3,5-dimethoxybenzoate |
| SMILES | COc1cc(OC)c(N)c(C(=O)OCCSC(F)(F)F)c1 |
| InChI | InChI=1S/C12H14F3NO4S/c1-18-7-5-8(10(16)9(6-7)19-2)11(17)20-3-4-21-12(13,14)15/h5-6H,3-4,16H2,1-2H3 |
| InChIKey | SOVVEKWZQKTJDC-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.31 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|