C14H19NO6 — CID 115626344
(1-ethoxy-1-oxopropan-2-yl) 2-amino-3,5-dimethoxybenzoate (PubChem CID 115626344) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (1-ethoxy-1-oxopropan-2-yl) 2-amino-3,5-dimethoxybenzoate.
| Compound Name | (1-ethoxy-1-oxopropan-2-yl) 2-amino-3,5-dimethoxybenzoate |
|---|---|
| PubChem CID | 115626344 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (1-ethoxy-1-oxopropan-2-yl) 2-amino-3,5-dimethoxybenzoate |
| SMILES | CCOC(=O)C(C)OC(=O)c1cc(OC)cc(OC)c1N |
| InChI | InChI=1S/C14H19NO6/c1-5-20-13(16)8(2)21-14(17)10-6-9(18-3)7-11(19-4)12(10)15/h6-8H,5,15H2,1-4H3 |
| InChIKey | LYBNBMCWLCMEAP-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 97.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|