C10H8F5NO2S — CID 116617284
2-(trifluoromethylsulfanyl)ethyl 2-amino-4,5-difluorobenzoate (PubChem CID 116617284) has the molecular formula C10H8F5NO2S and a molecular weight of 301.24 g/mol. Its IUPAC name is 2-(trifluoromethylsulfanyl)ethyl 2-amino-4,5-difluorobenzoate.
| Compound Name | 2-(trifluoromethylsulfanyl)ethyl 2-amino-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 116617284 |
| Molecular Formula | C10H8F5NO2S |
| Molecular Weight | 301.24 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-(trifluoromethylsulfanyl)ethyl 2-amino-4,5-difluorobenzoate |
| SMILES | Nc1cc(F)c(F)cc1C(=O)OCCSC(F)(F)F |
| InChI | InChI=1S/C10H8F5NO2S/c11-6-3-5(8(16)4-7(6)12)9(17)18-1-2-19-10(13,14)15/h3-4H,1-2,16H2 |
| InChIKey | HATKXYMIVMIAMY-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.24 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|