C13H17F2NO3 — CID 112688666
2-[(2-methylpropan-2-yl)oxy]ethyl 2-amino-4,5-difluorobenzoate (PubChem CID 112688666) has the molecular formula C13H17F2NO3 and a molecular weight of 273.28 g/mol. Its IUPAC name is 2-[(2-methylpropan-2-yl)oxy]ethyl 2-amino-4,5-difluorobenzoate.
| Compound Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 2-amino-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 112688666 |
| Molecular Formula | C13H17F2NO3 |
| Molecular Weight | 273.28 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-[(2-methylpropan-2-yl)oxy]ethyl 2-amino-4,5-difluorobenzoate |
| SMILES | CC(C)(C)OCCOC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C13H17F2NO3/c1-13(2,3)19-5-4-18-12(17)8-6-9(14)10(15)7-11(8)16/h6-7H,4-5,16H2,1-3H3 |
| InChIKey | YIQWTFDSLCRDHN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.28 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|