C11H11F2NO4 — CID 63950147
(3-methoxy-3-oxopropyl) 2-amino-4,5-difluorobenzoate (PubChem CID 63950147) has the molecular formula C11H11F2NO4 and a molecular weight of 259.21 g/mol. Its IUPAC name is (3-methoxy-3-oxopropyl) 2-amino-4,5-difluorobenzoate.
| Compound Name | (3-methoxy-3-oxopropyl) 2-amino-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 63950147 |
| Molecular Formula | C11H11F2NO4 |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | (3-methoxy-3-oxopropyl) 2-amino-4,5-difluorobenzoate |
| SMILES | COC(=O)CCOC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C11H11F2NO4/c1-17-10(15)2-3-18-11(16)6-4-7(12)8(13)5-9(6)14/h4-5H,2-3,14H2,1H3 |
| InChIKey | KKNYFXDNMFOTAP-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|