C13H13F2N3O2 — CID 103013618
2-(2-methylpyrazol-3-yl)ethyl 2-amino-4,5-difluorobenzoate (PubChem CID 103013618) has the molecular formula C13H13F2N3O2 and a molecular weight of 281.26 g/mol. Its IUPAC name is 2-(2-methylpyrazol-3-yl)ethyl 2-amino-4,5-difluorobenzoate.
| Compound Name | 2-(2-methylpyrazol-3-yl)ethyl 2-amino-4,5-difluorobenzoate |
|---|---|
| PubChem CID | 103013618 |
| Molecular Formula | C13H13F2N3O2 |
| Molecular Weight | 281.26 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(2-methylpyrazol-3-yl)ethyl 2-amino-4,5-difluorobenzoate |
| SMILES | Cn1nccc1CCOC(=O)c1cc(F)c(F)cc1N |
| InChI | InChI=1S/C13H13F2N3O2/c1-18-8(2-4-17-18)3-5-20-13(19)9-6-10(14)11(15)7-12(9)16/h2,4,6-7H,3,5,16H2,1H3 |
| InChIKey | AFDPESQHONCSTA-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.26 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|