About 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate
2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate (PubChem CID 103013683) has the molecular formula C15H19N3O3
and a molecular weight of 289.34 g/mol. Its IUPAC name is 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate.
Molecular Properties
| Compound Name | 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate |
| PubChem CID | 103013683 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate |
| SMILES | CCOc1c(N)cccc1C(=O)OCCc1ccnn1C |
| InChI | InChI=1S/C15H19N3O3/c1-3-20-14-12(5-4-6-13(14)16)15(19)21-10-8-11-7-9-17-18(11)2/h4-7,9H,3,8,10,16H2,1-2H3 |
| InChIKey | XIWTYMFSDVXBIL-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate?
The IUPAC name of 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate (CID 103013683) is 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate.
What is the SMILES notation for 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate?
The canonical SMILES for 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate is CCOc1c(N)cccc1C(=O)OCCc1ccnn1C.
What is the InChIKey of 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate?
The InChIKey is XIWTYMFSDVXBIL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19N3O3/c1-3-20-14-12(5-4-6-13(14)16)15(19)21-10-8-11-7-9-17-18(11)2/h4-7,9H,3,8,10,16H2,1-2H3.
What are the key properties of 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate?
2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate has a molecular weight of 289.34 g/mol, XLogP of 1.80, 6 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-methylpyrazol-3-yl)ethyl 3-amino-2-ethoxybenzoate is sourced from PubChem (CID 103013683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).