About (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate
(1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate (PubChem CID 113386665) has the molecular formula C12H16N2O4
and a molecular weight of 252.27 g/mol. Its IUPAC name is (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate.
Molecular Properties
| Compound Name | (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate |
| PubChem CID | 113386665 |
| Molecular Formula | C12H16N2O4 |
| Molecular Weight | 252.27 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate |
| SMILES | CCOc1c(N)cccc1C(=O)OC(C)C(N)=O |
| InChI | InChI=1S/C12H16N2O4/c1-3-17-10-8(5-4-6-9(10)13)12(16)18-7(2)11(14)15/h4-7H,3,13H2,1-2H3,(H2,14,15) |
| InChIKey | GYSMCSDCSNERFE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate?
The IUPAC name of (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate (CID 113386665) is (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate.
What is the SMILES notation for (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate?
The canonical SMILES for (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate is CCOc1c(N)cccc1C(=O)OC(C)C(N)=O.
What is the InChIKey of (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate?
The InChIKey is GYSMCSDCSNERFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4/c1-3-17-10-8(5-4-6-9(10)13)12(16)18-7(2)11(14)15/h4-7H,3,13H2,1-2H3,(H2,14,15).
What are the key properties of (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate?
(1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate has a molecular weight of 252.27 g/mol, XLogP of 0.70, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-amino-1-oxopropan-2-yl) 3-amino-2-ethoxybenzoate is sourced from PubChem (CID 113386665), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).