About 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate
2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate (PubChem CID 56504712) has the molecular formula C12H13NO5
and a molecular weight of 251.24 g/mol. Its IUPAC name is 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate.
Analyze 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate?
The IUPAC name of 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate (CID 56504712) is 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate.
What is the SMILES notation for 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate?
The canonical SMILES for 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate is COC(=O)c1ccccc1C(=O)OC(C)C(N)=O.
What is the InChIKey of 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate?
The InChIKey is LNHLCXIZLYQOBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO5/c1-7(10(13)14)18-12(16)9-6-4-3-5-8(9)11(15)17-2/h3-7H,1-2H3,(H2,13,14).
What are the key properties of 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate?
2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate has a molecular weight of 251.24 g/mol, XLogP of 0.50, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-O-(1-amino-1-oxopropan-2-yl) 1-O-methyl benzene-1,2-dicarboxylate is sourced from PubChem (CID 56504712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).