C17H17NO3 — CID 7382431
[(2S)-1-amino-1-oxopropan-2-yl] 2-benzylbenzoate (PubChem CID 7382431) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is [(2S)-1-amino-1-oxopropan-2-yl] 2-benzylbenzoate.
| Compound Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-benzylbenzoate |
|---|---|
| PubChem CID | 7382431 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | [(2S)-1-amino-1-oxopropan-2-yl] 2-benzylbenzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1Cc1ccccc1)C(N)=O |
| InChI | InChI=1S/C17H17NO3/c1-12(16(18)19)21-17(20)15-10-6-5-9-14(15)11-13-7-3-2-4-8-13/h2-10,12H,11H2,1H3,(H2,18,19)/t12-/m0/s1 |
| InChIKey | UQYPTTNQQXZNDE-LBPRGKRZSA-N |
| XLogP | 2.31 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |