C19H20N2O4 — CID 2609828
[(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(2-phenylethyl)benzoate (PubChem CID 2609828) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(2-phenylethyl)benzoate.
| Compound Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 2609828 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [(2S)-1-(carbamoylamino)-1-oxopropan-2-yl] 2-(2-phenylethyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccccc1CCc1ccccc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C19H20N2O4/c1-13(17(22)21-19(20)24)25-18(23)16-10-6-5-9-15(16)12-11-14-7-3-2-4-8-14/h2-10,13H,11-12H2,1H3,(H3,20,21,22,24)/t13-/m0/s1 |
| InChIKey | AICKGLYIGRWFKS-ZDUSSCGKSA-N |
| XLogP | 2.21 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |