C11H8Cl2FN3O2 — CID 71911967
(2-methylpyrazol-3-yl)methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate (PubChem CID 71911967) has the molecular formula C11H8Cl2FN3O2 and a molecular weight of 304.11 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate.
| Compound Name | (2-methylpyrazol-3-yl)methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate |
|---|---|
| PubChem CID | 71911967 |
| Molecular Formula | C11H8Cl2FN3O2 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 303.00 |
| IUPAC Name | (2-methylpyrazol-3-yl)methyl 2,6-dichloro-5-fluoropyridine-3-carboxylate |
| SMILES | Cn1nccc1COC(=O)c1cc(F)c(Cl)nc1Cl |
| InChI | InChI=1S/C11H8Cl2FN3O2/c1-17-6(2-3-15-17)5-19-11(18)7-4-8(14)10(13)16-9(7)12/h2-4H,5H2,1H3 |
| InChIKey | FZAHRHMUQDOLAD-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|