About (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate
(2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate (PubChem CID 134348473) has the molecular formula C9H10N4O2
and a molecular weight of 206.21 g/mol. Its IUPAC name is (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate |
| PubChem CID | 134348473 |
| Molecular Formula | C9H10N4O2 |
| Molecular Weight | 206.21 g/mol |
| Exact Mass | 206.08 |
| IUPAC Name | (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate |
| SMILES | Cn1nccc1COC(=O)n1ccnc1 |
| InChI | InChI=1S/C9H10N4O2/c1-12-8(2-3-11-12)6-15-9(14)13-5-4-10-7-13/h2-5,7H,6H2,1H3 |
| InChIKey | REYKKXMCYNQWKL-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 61.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.21 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate?
The IUPAC name of (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate (CID 134348473) is (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate.
What is the SMILES notation for (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate?
The canonical SMILES for (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate is Cn1nccc1COC(=O)n1ccnc1.
What is the InChIKey of (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate?
The InChIKey is REYKKXMCYNQWKL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N4O2/c1-12-8(2-3-11-12)6-15-9(14)13-5-4-10-7-13/h2-5,7H,6H2,1H3.
What are the key properties of (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate?
(2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate has a molecular weight of 206.21 g/mol, XLogP of 0.80, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpyrazol-3-yl)methyl imidazole-1-carboxylate is sourced from PubChem (CID 134348473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).