About 2-phenylethyl imidazole-1-carboxylate
2-phenylethyl imidazole-1-carboxylate (PubChem CID 15371420) has the molecular formula C12H12N2O2
and a molecular weight of 216.24 g/mol. Its IUPAC name is 2-phenylethyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | 2-phenylethyl imidazole-1-carboxylate |
| PubChem CID | 15371420 |
| Molecular Formula | C12H12N2O2 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.09 |
| IUPAC Name | 2-phenylethyl imidazole-1-carboxylate |
| SMILES | O=C(OCCc1ccccc1)n1ccnc1 |
| InChI | InChI=1S/C12H12N2O2/c15-12(14-8-7-13-10-14)16-9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2 |
| InChIKey | SCWXHPMRUNVMPK-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-phenylethyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenylethyl imidazole-1-carboxylate?
The IUPAC name of 2-phenylethyl imidazole-1-carboxylate (CID 15371420) is 2-phenylethyl imidazole-1-carboxylate.
What is the SMILES notation for 2-phenylethyl imidazole-1-carboxylate?
The canonical SMILES for 2-phenylethyl imidazole-1-carboxylate is O=C(OCCc1ccccc1)n1ccnc1.
What is the InChIKey of 2-phenylethyl imidazole-1-carboxylate?
The InChIKey is SCWXHPMRUNVMPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O2/c15-12(14-8-7-13-10-14)16-9-6-11-4-2-1-3-5-11/h1-5,7-8,10H,6,9H2.
What are the key properties of 2-phenylethyl imidazole-1-carboxylate?
2-phenylethyl imidazole-1-carboxylate has a molecular weight of 216.24 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenylethyl imidazole-1-carboxylate is sourced from PubChem (CID 15371420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).