About [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate
[(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate (PubChem CID 177444767) has the molecular formula C15H18N2O3
and a molecular weight of 274.32 g/mol. Its IUPAC name is [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate.
Molecular Properties
| Compound Name | [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate |
| PubChem CID | 177444767 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate |
| SMILES | C[C@H](CCOCc1ccccc1)OC(=O)n1ccnc1 |
| InChI | InChI=1S/C15H18N2O3/c1-13(20-15(18)17-9-8-16-12-17)7-10-19-11-14-5-3-2-4-6-14/h2-6,8-9,12-13H,7,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | JPMHGQHALKPBAP-CYBMUJFWSA-N |
| XLogP | 2.86 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate?
The IUPAC name of [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate (CID 177444767) is [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate.
What is the SMILES notation for [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate?
The canonical SMILES for [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate is C[C@H](CCOCc1ccccc1)OC(=O)n1ccnc1.
What is the InChIKey of [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate?
The InChIKey is JPMHGQHALKPBAP-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H18N2O3/c1-13(20-15(18)17-9-8-16-12-17)7-10-19-11-14-5-3-2-4-6-14/h2-6,8-9,12-13H,7,10-11H2,1H3/t13-/m1/s1.
What are the key properties of [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate?
[(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate has a molecular weight of 274.32 g/mol, XLogP of 2.86, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-phenylmethoxybutan-2-yl] imidazole-1-carboxylate is sourced from PubChem (CID 177444767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).