About [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate
[(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate (PubChem CID 10407159) has the molecular formula C15H21IO3
and a molecular weight of 376.23 g/mol. Its IUPAC name is [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate.
Molecular Properties
| Compound Name | [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate |
| PubChem CID | 10407159 |
| Molecular Formula | C15H21IO3 |
| Molecular Weight | 376.23 g/mol |
| Exact Mass | 376.05 |
| IUPAC Name | [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate |
| SMILES | C[C@H](CCI)OC(=O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C15H21IO3/c1-13(9-10-16)19-15(17)8-5-11-18-12-14-6-3-2-4-7-14/h2-4,6-7,13H,5,8-12H2,1H3/t13-/m1/s1 |
| InChIKey | DMUCXWHYHRWUAD-CYBMUJFWSA-N |
| XLogP | 3.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.23 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate?
The IUPAC name of [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate (CID 10407159) is [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate.
What is the SMILES notation for [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate?
The canonical SMILES for [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate is C[C@H](CCI)OC(=O)CCCOCc1ccccc1.
What is the InChIKey of [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate?
The InChIKey is DMUCXWHYHRWUAD-CYBMUJFWSA-N. The full InChI is InChI=1S/C15H21IO3/c1-13(9-10-16)19-15(17)8-5-11-18-12-14-6-3-2-4-7-14/h2-4,6-7,13H,5,8-12H2,1H3/t13-/m1/s1.
What are the key properties of [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate?
[(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate has a molecular weight of 376.23 g/mol, XLogP of 3.74, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-4-iodobutan-2-yl] 4-phenylmethoxybutanoate is sourced from PubChem (CID 10407159), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).