About chloro 4-phenylmethoxybutanoate
chloro 4-phenylmethoxybutanoate (PubChem CID 143253301) has the molecular formula C11H13ClO3
and a molecular weight of 228.68 g/mol. Its IUPAC name is chloro 4-phenylmethoxybutanoate.
Molecular Properties
| Compound Name | chloro 4-phenylmethoxybutanoate |
| PubChem CID | 143253301 |
| Molecular Formula | C11H13ClO3 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | chloro 4-phenylmethoxybutanoate |
| SMILES | O=C(CCCOCc1ccccc1)OCl |
| InChI | InChI=1S/C11H13ClO3/c12-15-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2 |
| InChIKey | NCJAJHQRQYAJKA-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze chloro 4-phenylmethoxybutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloro 4-phenylmethoxybutanoate?
The IUPAC name of chloro 4-phenylmethoxybutanoate (CID 143253301) is chloro 4-phenylmethoxybutanoate.
What is the SMILES notation for chloro 4-phenylmethoxybutanoate?
The canonical SMILES for chloro 4-phenylmethoxybutanoate is O=C(CCCOCc1ccccc1)OCl.
What is the InChIKey of chloro 4-phenylmethoxybutanoate?
The InChIKey is NCJAJHQRQYAJKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClO3/c12-15-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h1-3,5-6H,4,7-9H2.
What are the key properties of chloro 4-phenylmethoxybutanoate?
chloro 4-phenylmethoxybutanoate has a molecular weight of 228.68 g/mol, XLogP of 2.68, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for chloro 4-phenylmethoxybutanoate is sourced from PubChem (CID 143253301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).