C14H16N4O3 — CID 167081038
benzyl N-[(1S)-1-amino-3-imidazol-1-yl-3-oxopropyl]carbamate (PubChem CID 167081038) has the molecular formula C14H16N4O3 and a molecular weight of 288.31 g/mol. Its IUPAC name is benzyl N-[(1S)-1-amino-3-imidazol-1-yl-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-amino-3-imidazol-1-yl-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 167081038 |
| Molecular Formula | C14H16N4O3 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | benzyl N-[(1S)-1-amino-3-imidazol-1-yl-3-oxopropyl]carbamate |
| SMILES | N[C@H](CC(=O)n1ccnc1)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C14H16N4O3/c15-12(8-13(19)18-7-6-16-10-18)17-14(20)21-9-11-4-2-1-3-5-11/h1-7,10,12H,8-9,15H2,(H,17,20)/t12-/m0/s1 |
| InChIKey | IYSNDWZRFIEEIJ-LBPRGKRZSA-N |
| XLogP | 1.12 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|