About butyl imidazole-1-carboxylate
butyl imidazole-1-carboxylate (PubChem CID 12840941) has the molecular formula C8H12N2O2
and a molecular weight of 168.20 g/mol. Its IUPAC name is butyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | butyl imidazole-1-carboxylate |
| PubChem CID | 12840941 |
| Molecular Formula | C8H12N2O2 |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.09 |
| IUPAC Name | butyl imidazole-1-carboxylate |
| SMILES | CCCCOC(=O)n1ccnc1 |
| InChI | InChI=1S/C8H12N2O2/c1-2-3-6-12-8(11)10-5-4-9-7-10/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | XOSAJQPRWISAMV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze butyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl imidazole-1-carboxylate?
The IUPAC name of butyl imidazole-1-carboxylate (CID 12840941) is butyl imidazole-1-carboxylate.
What is the SMILES notation for butyl imidazole-1-carboxylate?
The canonical SMILES for butyl imidazole-1-carboxylate is CCCCOC(=O)n1ccnc1.
What is the InChIKey of butyl imidazole-1-carboxylate?
The InChIKey is XOSAJQPRWISAMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2O2/c1-2-3-6-12-8(11)10-5-4-9-7-10/h4-5,7H,2-3,6H2,1H3.
What are the key properties of butyl imidazole-1-carboxylate?
butyl imidazole-1-carboxylate has a molecular weight of 168.20 g/mol, XLogP of 1.67, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for butyl imidazole-1-carboxylate is sourced from PubChem (CID 12840941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).