About 1-benzofuran-2-ylmethyl imidazole-1-carboxylate
1-benzofuran-2-ylmethyl imidazole-1-carboxylate (PubChem CID 142027707) has the molecular formula C13H10N2O3
and a molecular weight of 242.23 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl imidazole-1-carboxylate.
Molecular Properties
| Compound Name | 1-benzofuran-2-ylmethyl imidazole-1-carboxylate |
| PubChem CID | 142027707 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 1-benzofuran-2-ylmethyl imidazole-1-carboxylate |
| SMILES | O=C(OCc1cc2ccccc2o1)n1ccnc1 |
| InChI | InChI=1S/C13H10N2O3/c16-13(15-6-5-14-9-15)17-8-11-7-10-3-1-2-4-12(10)18-11/h1-7,9H,8H2 |
| InChIKey | JWXVAHULEHHSIN-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 57.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-benzofuran-2-ylmethyl imidazole-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-ylmethyl imidazole-1-carboxylate?
The IUPAC name of 1-benzofuran-2-ylmethyl imidazole-1-carboxylate (CID 142027707) is 1-benzofuran-2-ylmethyl imidazole-1-carboxylate.
What is the SMILES notation for 1-benzofuran-2-ylmethyl imidazole-1-carboxylate?
The canonical SMILES for 1-benzofuran-2-ylmethyl imidazole-1-carboxylate is O=C(OCc1cc2ccccc2o1)n1ccnc1.
What is the InChIKey of 1-benzofuran-2-ylmethyl imidazole-1-carboxylate?
The InChIKey is JWXVAHULEHHSIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3/c16-13(15-6-5-14-9-15)17-8-11-7-10-3-1-2-4-12(10)18-11/h1-7,9H,8H2.
What are the key properties of 1-benzofuran-2-ylmethyl imidazole-1-carboxylate?
1-benzofuran-2-ylmethyl imidazole-1-carboxylate has a molecular weight of 242.23 g/mol, XLogP of 2.81, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-ylmethyl imidazole-1-carboxylate is sourced from PubChem (CID 142027707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).