About 1-benzofuran-2-ylmethyl 2-ethylbutanoate
1-benzofuran-2-ylmethyl 2-ethylbutanoate (PubChem CID 86918284) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl 2-ethylbutanoate.
Molecular Properties
| Compound Name | 1-benzofuran-2-ylmethyl 2-ethylbutanoate |
| PubChem CID | 86918284 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | 1-benzofuran-2-ylmethyl 2-ethylbutanoate |
| SMILES | CCC(CC)C(=O)OCc1cc2ccccc2o1 |
| InChI | InChI=1S/C15H18O3/c1-3-11(4-2)15(16)17-10-13-9-12-7-5-6-8-14(12)18-13/h5-9,11H,3-4,10H2,1-2H3 |
| InChIKey | MUBULEGYZPVCLQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzofuran-2-ylmethyl 2-ethylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-ylmethyl 2-ethylbutanoate?
The IUPAC name of 1-benzofuran-2-ylmethyl 2-ethylbutanoate (CID 86918284) is 1-benzofuran-2-ylmethyl 2-ethylbutanoate.
What is the SMILES notation for 1-benzofuran-2-ylmethyl 2-ethylbutanoate?
The canonical SMILES for 1-benzofuran-2-ylmethyl 2-ethylbutanoate is CCC(CC)C(=O)OCc1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-ylmethyl 2-ethylbutanoate?
The InChIKey is MUBULEGYZPVCLQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3/c1-3-11(4-2)15(16)17-10-13-9-12-7-5-6-8-14(12)18-13/h5-9,11H,3-4,10H2,1-2H3.
What are the key properties of 1-benzofuran-2-ylmethyl 2-ethylbutanoate?
1-benzofuran-2-ylmethyl 2-ethylbutanoate has a molecular weight of 246.31 g/mol, XLogP of 3.91, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-ylmethyl 2-ethylbutanoate is sourced from PubChem (CID 86918284), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).