C14H17NO3 — CID 53397244
ethyl 3-(1-benzofuran-2-ylmethylamino)propanoate (PubChem CID 53397244) has the molecular formula C14H17NO3 and a molecular weight of 247.29 g/mol. Its IUPAC name is ethyl 3-(1-benzofuran-2-ylmethylamino)propanoate.
| Compound Name | ethyl 3-(1-benzofuran-2-ylmethylamino)propanoate |
|---|---|
| PubChem CID | 53397244 |
| Molecular Formula | C14H17NO3 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.12 |
| IUPAC Name | ethyl 3-(1-benzofuran-2-ylmethylamino)propanoate |
| SMILES | CCOC(=O)CCNCc1cc2ccccc2o1 |
| InChI | InChI=1S/C14H17NO3/c1-2-17-14(16)7-8-15-10-12-9-11-5-3-4-6-13(11)18-12/h3-6,9,15H,2,7-8,10H2,1H3 |
| InChIKey | XAPGYKBRIQFPCM-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|