C14H20N2O — CID 28618146
N-(1-benzofuran-2-ylmethyl)-N',N'-dimethylpropane-1,3-diamine (PubChem CID 28618146) has the molecular formula C14H20N2O and a molecular weight of 232.33 g/mol. Its IUPAC name is N-(1-benzofuran-2-ylmethyl)-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-(1-benzofuran-2-ylmethyl)-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 28618146 |
| Molecular Formula | C14H20N2O |
| Molecular Weight | 232.33 g/mol |
| Exact Mass | 232.16 |
| IUPAC Name | N-(1-benzofuran-2-ylmethyl)-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CN(C)CCCNCc1cc2ccccc2o1 |
| InChI | InChI=1S/C14H20N2O/c1-16(2)9-5-8-15-11-13-10-12-6-3-4-7-14(12)17-13/h3-4,6-7,10,15H,5,8-9,11H2,1-2H3 |
| InChIKey | KVWMEALFBMXFSI-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 28.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.33 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|