About 1-benzofuran-2-ylmethyl formate
1-benzofuran-2-ylmethyl formate (PubChem CID 18617223) has the molecular formula C10H8O3
and a molecular weight of 176.17 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl formate.
Molecular Properties
| Compound Name | 1-benzofuran-2-ylmethyl formate |
| PubChem CID | 18617223 |
| Molecular Formula | C10H8O3 |
| Molecular Weight | 176.17 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | 1-benzofuran-2-ylmethyl formate |
| SMILES | O=COCc1cc2ccccc2o1 |
| InChI | InChI=1S/C10H8O3/c11-7-12-6-9-5-8-3-1-2-4-10(8)13-9/h1-5,7H,6H2 |
| InChIKey | FVSHEUHZHKVPHG-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.17 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-2-ylmethyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-ylmethyl formate?
The IUPAC name of 1-benzofuran-2-ylmethyl formate (CID 18617223) is 1-benzofuran-2-ylmethyl formate.
What is the SMILES notation for 1-benzofuran-2-ylmethyl formate?
The canonical SMILES for 1-benzofuran-2-ylmethyl formate is O=COCc1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-ylmethyl formate?
The InChIKey is FVSHEUHZHKVPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O3/c11-7-12-6-9-5-8-3-1-2-4-10(8)13-9/h1-5,7H,6H2.
What are the key properties of 1-benzofuran-2-ylmethyl formate?
1-benzofuran-2-ylmethyl formate has a molecular weight of 176.17 g/mol, XLogP of 2.11, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-ylmethyl formate is sourced from PubChem (CID 18617223), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).